101651-69-8 Usage
Molecular structure
The compound consists of a diethyl-azanium cation and a chloride anion, with a carbamoyl group attached to a methylsulfanyl group, connected to an ethyl group, and two chlorophenyl groups.
Functional groups
The presence of a diethyl-azanium cation (positively charged ion) and a chloride anion (negatively charged ion), a carbamoyl group, a methylsulfanyl group, and two chlorophenyl groups.
Charge distribution
The compound has a positively charged diethyl-azanium cation and a negatively charged chloride anion, resulting in an ionic bond between the two ions.
Chlorine content
The presence of two chlorine atoms attached to a phenyl ring indicates that the compound has a dichlorophenyl group, which may influence its chemical properties and reactivity.
Industrial and research applications
Due to its complex and specific chemical structure, 2-[(2,6-dichlorophenyl)carbamoylmethylsulfanyl]ethyl-diethyl-azanium chloride likely has various applications in industries or research settings, such as pharmaceuticals, agrochemicals, or materials science.
Reactivity
The presence of multiple functional groups and the dichlorophenyl group may contribute to the compound's reactivity with other chemicals, potentially allowing it to undergo various chemical reactions and form new compounds.
Polarity
The compound's structure, with its positively and negatively charged ions and polar functional groups, likely results in a polar molecule, which can influence its solubility, boiling point, and other physical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 101651-69-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,6,5 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 101651-69:
(8*1)+(7*0)+(6*1)+(5*6)+(4*5)+(3*1)+(2*6)+(1*9)=88
88 % 10 = 8
So 101651-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H20Cl2N2OS.ClH/c1-3-18(4-2)8-9-20-10-13(19)17-14-11(15)6-5-7-12(14)16;/h5-7H,3-4,8-10H2,1-2H3,(H,17,19);1H
