1016642-07-1 Usage
Uses
Used in Organic Synthesis:
2-Thiazole-4-boronic acid is used as a reagent in various chemical reactions, particularly in the Suzuki reaction, which is a type of cross-coupling reaction used in organic synthesis. This reaction allows for the formation of carbon-carbon bonds, facilitating the synthesis of complex organic molecules.
Used as a Sugar Sensor in Biological Systems:
Due to its ability to covalently bind to sugar diols, 2-Thiazole-4-boronic acid is used as a sugar sensor in biological systems. This application is valuable for detecting and monitoring the presence of specific sugars, which can be important in various research and diagnostic contexts.
Check Digit Verification of cas no
The CAS Registry Mumber 1016642-07-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,1,6,6,4 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1016642-07:
(9*1)+(8*0)+(7*1)+(6*6)+(5*6)+(4*4)+(3*2)+(2*0)+(1*7)=111
111 % 10 = 1
So 1016642-07-1 is a valid CAS Registry Number.
InChI:InChI=1S/C3H4BNO2S/c6-4(7)3-1-8-2-5-3/h1-2,6-7H
