10176-23-5 Usage
Uses
Used in Pharmaceutical Development:
METHYL (3-CHLOROQUINOXALIN-2-YL)(CYANO)ACETATE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique structure allows for the creation of compounds with specific therapeutic properties, making it a valuable asset in medicinal chemistry.
Used in Agrochemicals:
In the agrochemical industry, METHYL (3-CHLOROQUINOXALIN-2-YL)(CYANO)ACETATE is used as a building block in the formulation of pesticides and other agricultural chemicals. Its chemical properties can be harnessed to create effective compounds that protect crops from pests and diseases.
Used in Materials Science:
METHYL (3-CHLOROQUINOXALIN-2-YL)(CYANO)ACETATE is utilized as a component in the development of new materials. Its functional groups and structural features can be integrated into the design of advanced materials with specific properties, such as improved stability or reactivity, for use in various applications.
Each of these uses capitalizes on the compound's distinctive chemical attributes, highlighting its versatility and potential impact on multiple sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 10176-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,7 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10176-23:
(7*1)+(6*0)+(5*1)+(4*7)+(3*6)+(2*2)+(1*3)=65
65 % 10 = 5
So 10176-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H8ClN3O2/c1-18-12(17)7(6-14)10-11(13)16-9-5-3-2-4-8(9)15-10/h2-5,7H,1H3
