10176-23-5 Usage
General Description
Methyl (3-chloroquinoxalin-2-yl)(cyano)acetate is a chemical compound with the molecular formula C12H8ClN3O2. It is a derivative of quinoxaline, which is a heterocyclic compound commonly used in pharmaceuticals and organic synthesis. This particular compound contains a methyl group, a cyano group, and a chloro group attached to a quinoxaline ring. It has potential applications in the development of novel pharmaceuticals, agrochemicals, and materials. The compound's unique chemical structure and functional groups make it valuable for further research and potential commercial applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10176-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,7 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10176-23:
(7*1)+(6*0)+(5*1)+(4*7)+(3*6)+(2*2)+(1*3)=65
65 % 10 = 5
So 10176-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H8ClN3O2/c1-18-12(17)7(6-14)10-11(13)16-9-5-3-2-4-8(9)15-10/h2-5,7H,1H3
