10179-83-6 Usage
General Description
7-methyl-v-Triazolo[4,5-d]pyrimidine is a chemical compound with the molecular formula C5H5N5. It is a heterocyclic organic compound that contains a triazolopyrimidine ring system. v-Triazolo[4,5-d]pyrimidine, 7-methyl- (7CI,8CI) has potential applications in medicinal chemistry and drug development, as it can serve as a scaffold for the synthesis of various bioactive compounds. Its structure and properties make it a valuable building block for the design of new pharmaceuticals with potential therapeutic applications. Additionally, its unique chemical structure makes it an interesting target for further research and exploration in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 10179-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,7 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10179-83:
(7*1)+(6*0)+(5*1)+(4*7)+(3*9)+(2*8)+(1*3)=86
86 % 10 = 6
So 10179-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5/c1-3-4-5(7-2-6-3)9-10-8-4/h2,4H,1H3