101937-67-1 Usage
General Description
2-(N-(4-chlorophenyl)carbamoyl)cyclohexanecarboxylic acid is a chemical compound containing a cyclohexane ring with a carboxylic acid group and a carbamoyl group attached to it. The carbamoyl group has a 4-chlorophenyl substituent, giving the compound its specific structure. This chemical may have applications in pharmaceuticals, particularly as a potential drug target or as a building block for the synthesis of other compounds. Its properties and potential uses would likely depend on its specific chemical and biological characteristics, which would need to be further studied and evaluated.
Check Digit Verification of cas no
The CAS Registry Mumber 101937-67-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,9,3 and 7 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 101937-67:
(8*1)+(7*0)+(6*1)+(5*9)+(4*3)+(3*7)+(2*6)+(1*7)=111
111 % 10 = 1
So 101937-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H16ClNO3/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(18)19/h5-8,11-12H,1-4H2,(H,16,17)(H,18,19)
