10197-64-5 Usage
Description
Methyl (5Z)-5-(dimethylaminohydrazinylidene)imidazole-4-carboxylate is a chemical compound with the molecular formula C8H12N6O2. It is a methyl ester derivative of imidazole-4-carboxylic acid, featuring a dimethylaminohydrazine functional group. methyl (5Z)-5-(dimethylaminohydrazinylidene)imidazole-4-carboxylate has potential applications in pharmaceutical research and development, as it can serve as a ligand for metal coordination complexes. Its biological activity is under investigation, with further studies required to elucidate its specific biochemical properties and potential uses.
Uses
Used in Pharmaceutical Research and Development:
Methyl (5Z)-5-(dimethylaminohydrazinylidene)imidazole-4-carboxylate is utilized as a ligand for metal coordination complexes in pharmaceutical research and development. Its unique structure and functional groups contribute to the formation of metal complexes with potential applications in medicinal chemistry.
Used in Organic Synthesis:
As a building block in organic synthesis, methyl (5Z)-5-(dimethylaminohydrazinylidene)imidazole-4-carboxylate is employed in various chemical reactions involving imidazole and dimethylaminohydrazine precursors. Its versatility in synthesis allows for the creation of diverse organic compounds with potential applications in different industries.
Used in Chemical Research:
Methyl (5Z)-5-(dimethylaminohydrazinylidene)imidazole-4-carboxylate is also used in chemical research to explore its potential biological activity and other properties. Further studies are needed to determine its specific biochemical characteristics and possible applications in various fields, such as drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 10197-64-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,9 and 7 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10197-64:
(7*1)+(6*0)+(5*1)+(4*9)+(3*7)+(2*6)+(1*4)=85
85 % 10 = 5
So 10197-64-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N5O2/c1-12(2)11-10-6-5(7(13)14-3)8-4-9-6/h4,11H,1-3H3/b10-6+