101970-41-6 Usage
Uses
Used in Pharmaceutical Industry:
4-(4-Acetyl-piperazin-1-yl)-2-chloroaniline is used as a starting material for the synthesis of various pharmaceutical compounds. Its unique functional groups contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(4-Acetyl-piperazin-1-yl)-2-chloroaniline is utilized as a precursor in the production of agrochemicals. Its properties allow for the creation of compounds that can be used in pest control and crop protection.
Used in Materials Science:
4-(4-Acetyl-piperazin-1-yl)-2-chloroaniline is employed in materials science for the development of new materials with specific properties. Its functional groups can be manipulated to create materials with tailored characteristics for various applications.
Used in Research and Scientific Studies:
As a white solid with distinctive functional groups, 4-(4-Acetyl-piperazin-1-yl)-2-chloroaniline is used in research and scientific studies to explore its chemical properties and potential reactions. This helps in understanding its behavior and applicability in different chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 101970-41-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,9,7 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 101970-41:
(8*1)+(7*0)+(6*1)+(5*9)+(4*7)+(3*0)+(2*4)+(1*1)=96
96 % 10 = 6
So 101970-41-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClN3O/c1-9(17)15-4-6-16(7-5-15)10-2-3-12(14)11(13)8-10/h2-3,8H,4-7,14H2,1H3
