102-68-1 Usage
Description
1,1-bis(vinyloxy)butane, also known as 1,1-bis(ethenoxy)butane, is a chemical compound characterized by a butane molecule (a four-carbon alkane) with two vinyloxy (-OCH=CH2) groups attached to the same carbon atom at the center of the molecule. This unique structure makes it a valuable building block or reactant in the synthesis of more complex organic molecules, particularly in the fields of polymer chemistry and materials science.
Uses
Used in Organic Synthesis:
1,1-bis(vinyloxy)butane is used as a building block for the creation of more complex organic molecules. Its presence in the molecular structure allows for the formation of various linkages and functional groups, which are essential in the synthesis of advanced materials and compounds.
Used in Polymer Chemistry:
1,1-bis(vinyloxy)butane is used as a monomer in the polymerization process to produce polymers with specific properties. The vinyloxy groups facilitate the formation of polymer chains through a process known as copolymerization, where the compound reacts with other monomers to form a polymer with tailored characteristics.
Used in Materials Science:
1,1-bis(vinyloxy)butane is used as a reactant in the development of new materials with unique properties. 1,1-bis(vinyloxy)butane's ability to form covalent bonds with other molecules allows for the creation of materials with enhanced mechanical, thermal, or electrical properties, depending on the specific application.
Used in Research:
1,1-bis(vinyloxy)butane is used as a reactant in various research applications, particularly in the study of reaction mechanisms and the development of new synthetic methods. Its reactivity and versatility make it an essential tool for chemists working on the frontiers of organic chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 102-68-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 102-68:
(5*1)+(4*0)+(3*2)+(2*6)+(1*8)=31
31 % 10 = 1
So 102-68-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2/c1-4-7-8(9-5-2)10-6-3/h5-6,8H,2-4,7H2,1H3