102170-51-4 Usage
Uses
Used in Organic Synthesis:
3-Carbamoyl-5-nitrophenylboronic acid is used as a building block in the synthesis of various pharmaceuticals, agrochemicals, and materials. Its unique structure allows for the formation of carbon-carbon bonds through Suzuki-Miyaura cross-coupling reactions, facilitating the creation of complex organic molecules.
Used in Pharmaceutical Industry:
3-Carbamoyl-5-nitrophenylboronic acid is used as a reagent in the development of new drugs. Its potential anti-cancer properties make it a promising candidate for the treatment of various types of cancer. Additionally, its anti-inflammatory properties suggest its potential use in managing inflammatory conditions.
Used in Agrochemical Industry:
3-Carbamoyl-5-nitrophenylboronic acid is used as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical properties enable the development of novel compounds with improved efficacy and selectivity in controlling pests and weeds.
Used in Material Science:
3-Carbamoyl-5-nitrophenylboronic acid is used in the development of new materials with specific properties, such as conductivity, magnetism, or optical characteristics. Its ability to form carbon-carbon bonds through cross-coupling reactions allows for the creation of advanced materials with tailored properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 102170-51-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,1,7 and 0 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 102170-51:
(8*1)+(7*0)+(6*2)+(5*1)+(4*7)+(3*0)+(2*5)+(1*1)=64
64 % 10 = 4
So 102170-51-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BN2O5/c9-7(11)4-1-5(8(12)13)3-6(2-4)10(14)15/h1-3,12-13H,(H2,9,11)
