102187-19-9 Usage
General Description
2-PHENYLCARBAMOYL-1,4-NAPHTHOQUINONE-4-(4-DIETHYLAMINO-2-METHYLPHENYL)IMINE is a synthetic chemical compound with potential applications in the field of organic chemistry and medicinal research. It is a complex molecule containing a carbamoyl group, a naphthoquinone moiety, and an imine group, among other functional groups. The presence of these functional groups suggests that the compound may have antibacterial, antifungal, or antitumor properties, although further studies are required to confirm these potential effects. Additionally, the presence of the diethylamino-2-methylphenyl group suggests that this compound may also have potential applications as a dye or fluorescent marker in biological research. Overall, 2-PHENYLCARBAMOYL-1,4-NAPHTHOQUINONE-4-(4-DIETHYLAMINO-2-METHYLPHENYL)IMINE is a versatile compound with a wide range of potential applications in the fields of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 102187-19-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,1,8 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 102187-19:
(8*1)+(7*0)+(6*2)+(5*1)+(4*8)+(3*7)+(2*1)+(1*9)=89
89 % 10 = 9
So 102187-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C28H27N3O2/c1-4-31(5-2)21-15-16-25(19(3)17-21)30-26-18-24(27(32)23-14-10-9-13-22(23)26)28(33)29-20-11-7-6-8-12-20/h6-18H,4-5H2,1-3H3,(H,29,33)/b30-26+