10220-53-8 Usage
General Description
2-(dodecylthio)acetamide is a chemical compound with the molecular formula C16H33NO2S. It is a long-chain thioamide derivative that is often used as an intermediate in organic synthesis. 2-(dodecylthio)acetamide has a dodecylthio group attached to the acetamide functional group, making it suitable for various industrial applications. It can be used as a lubricant additive, a corrosion inhibitor, and a surfactant in various industrial processes. Additionally, 2-(dodecylthio)acetamide has potential antimicrobial properties, and it has been studied for its potential use in pharmaceuticals and personal care products.
Check Digit Verification of cas no
The CAS Registry Mumber 10220-53-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10220-53:
(7*1)+(6*0)+(5*2)+(4*2)+(3*0)+(2*5)+(1*3)=38
38 % 10 = 8
So 10220-53-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H29NOS/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-14(15)16/h2-13H2,1H3,(H2,15,16)