10226-37-6 Usage
Description
(5-Methoxy-1H-indazol-3-yl)acetic acid, an indazole derivative, is a white to pale-yellow solid with the molecular formula C11H10N2O3. It is recognized for its potential as a building block in the synthesis of pharmaceuticals and agrochemicals, and has been studied for its pharmacological properties, such as its ability to act as a selective COX-2 inhibitor. This makes it a promising candidate for the treatment of inflammatory conditions. Its unique chemical structure and potential biological activities position it as an intriguing compound for further research and development in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
(5-Methoxy-1H-indazol-3-yl)acetic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its role in the development of new drugs is attributed to its potential as a selective COX-2 inhibitor, which could be instrumental in managing inflammatory conditions.
Used in Agrochemical Industry:
In the agrochemical sector, (5-Methoxy-1H-indazol-3-yl)acetic acid serves as a key component in the creation of agrochemicals. Its specific applications may include the development of pesticides or other agricultural chemicals that can enhance crop protection and yield.
Used in Medicinal Chemistry Research:
(5-Methoxy-1H-indazol-3-yl)acetic acid is utilized as a subject of study in medicinal chemistry research. Its unique structure and potential biological activities are of interest to scientists who aim to uncover new therapeutic agents or understand its mechanisms of action for existing conditions, particularly those related to inflammation.
Check Digit Verification of cas no
The CAS Registry Mumber 10226-37-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10226-37:
(7*1)+(6*0)+(5*2)+(4*2)+(3*6)+(2*3)+(1*7)=56
56 % 10 = 6
So 10226-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O3/c1-15-6-2-3-8-7(4-6)9(12-11-8)5-10(13)14/h2-4H,5H2,1H3,(H,11,12)(H,13,14)
