10227-64-2 Usage
General Description
Ethanone, 1-(1H-benzimidazol-2-yl)-2-chloro- (9CI) is a chemical compound that contains a benzimidazole ring and a chlorine atom attached to a ketone group. Benzimidazole is a heterocyclic compound with a fused benzene and imidazole ring structure, while the ketone group consists of a carbon atom double-bonded to an oxygen atom. Ethanone, 1-(1H-benzimidazol-2-yl)-2-chloro- (9CI) may have applications in various fields, including pharmaceuticals, agrochemicals, and materials science, due to its unique molecular structure and potential reactivity. Further research and testing may be necessary to understand the specific properties and potential uses of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 10227-64-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 7 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10227-64:
(7*1)+(6*0)+(5*2)+(4*2)+(3*7)+(2*6)+(1*4)=62
62 % 10 = 2
So 10227-64-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClN2O/c10-5-8(13)9-11-6-3-1-2-4-7(6)12-9/h1-4H,5H2,(H,11,12)