10228-01-0 Usage
Uses
Used in Pharmaceutical Research:
5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione is used as a research compound for its potential as an anticancer agent. Its unique structure and biological activities make it a promising candidate for the development of new cancer therapies.
Used in Medicinal Chemistry:
As a quinone derivative, 5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione is used in medicinal chemistry for its potential as a redox-active compound. Its properties may contribute to the development of new drugs and therapeutic agents.
Used in Antiviral Applications:
5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione is also being studied for its potential as an antiviral agent. Its unique structure and biological activities may offer new avenues for the development of antiviral therapies.
Used in Drug Discovery:
5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione's potential pharmacological properties make it a valuable asset in drug discovery. Its exploration may lead to the identification of new drug targets and the development of novel therapeutic agents.
Used in Chemical Applications:
As a quinone derivative, 5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione may have potential applications in various fields of science and technology, including as a redox-active compound in chemical processes and reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 10228-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10228-01:
(7*1)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*1)=50
50 % 10 = 0
So 10228-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H14N2O2/c1-11-6-7-17-13(8-11)21(25)15-10-18-14(9-19(15)23-17)20(24)12-4-2-3-5-16(12)22-18/h2-10H,1H3,(H,22,24)(H,23,25)
10228-01-0Relevant articles and documents
Quinacridone pigment compositions comprising unsymmetrically substituted components
-
Page 13, (2010/02/10)
The present invention relates to a novel quinacridone pigment compositions, a process using a mixed amine synthesis for the ultimate production of the compositions and to their use as colorants for pigmenting high molecular weight organic materials.