10228-01-0 Usage
General Description
5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione is a chemical compound with a complex structure, belonging to the quinone family. It is a synthetic derivative of acridine and has potential applications in medicinal chemistry and pharmaceutical research. The compound has been studied for its biological activities, including its potential as an anticancer and antiviral agent. Its chemical structure and unique properties make it a promising candidate for further exploration in drug discovery and development. As a quinone derivative, it may have potential as a redox-active compound with potential applications in various fields of science and technology. Overall, 5,12-dihydro-2-methylquino[2,3-b]acridine-7,14-dione is a compound of interest for its potential pharmacological and chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10228-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10228-01:
(7*1)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*1)=50
50 % 10 = 0
So 10228-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H14N2O2/c1-11-6-7-17-13(8-11)21(25)15-10-18-14(9-19(15)23-17)20(24)12-4-2-3-5-16(12)22-18/h2-10H,1H3,(H,22,24)(H,23,25)
10228-01-0Relevant articles and documents
Quinacridone pigment compositions comprising unsymmetrically substituted components
-
Page 13, (2010/02/10)
The present invention relates to a novel quinacridone pigment compositions, a process using a mixed amine synthesis for the ultimate production of the compositions and to their use as colorants for pigmenting high molecular weight organic materials.