10228-03-2 Usage
General Description
2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol is a chemical compound with the molecular formula C10H14N4O3. It is a synthetic compound used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. 2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol is a derivative of anilines and contains a nitro group, an amino group, and a methyl group. It is commonly used in the production of pharmaceuticals due to its ability to react with other chemical compounds to form new and useful drugs. Additionally, it is also known for its potential application in organic synthesis and chemical research. However, this compound should be handled with care due to its potential toxicity and health hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 10228-03-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10228-03:
(7*1)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*3)=52
52 % 10 = 2
So 10228-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O3/c1-11-9-4-3-8(12(2)5-6-14)7-10(9)13(15)16/h3-4,7,11,14H,5-6H2,1-2H3
