10228-03-2 Usage
Uses
Used in Pharmaceutical Industry:
2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol is used as a chemical intermediate for the synthesis of various drugs. Its unique structure allows it to react with other compounds, facilitating the creation of new pharmaceuticals with potential therapeutic benefits.
Used in Organic Synthesis:
In the field of organic synthesis, 2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol is employed as a building block for the development of complex organic molecules. Its functional groups enable it to participate in various chemical reactions, contributing to the synthesis of a wide range of organic compounds.
Used in Chemical Research:
2-[N-methyl-4-(methylamino)-3-nitroanilino]ethanol is also utilized in chemical research to study the properties and reactivity of aniline derivatives. Its potential applications in the development of new chemical processes and the understanding of reaction mechanisms make it a valuable compound for scientific investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 10228-03-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10228-03:
(7*1)+(6*0)+(5*2)+(4*2)+(3*8)+(2*0)+(1*3)=52
52 % 10 = 2
So 10228-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15N3O3/c1-11-9-4-3-8(12(2)5-6-14)7-10(9)13(15)16/h3-4,7,11,14H,5-6H2,1-2H3
