102392-83-6 Usage
General Description
PYRROLIDINE-1-CARBOXIMIDAMIDE HYDROIODIDE is a chemical compound that is often used in organic synthesis and pharmaceutical research. It is a hydroiodide salt of pyrrolidine-1-carboximidamide, which is a derivative of the amino acid proline. PYRROLIDINE-1-CARBOXIMIDAMIDE HYDROIODIDE is known for its ability to act as a catalyst in various reactions, including the formation of carbon-carbon bonds and the synthesis of heterocyclic compounds. It is also used in the development of pharmaceuticals, particularly in the creation of potential drug candidates for the treatment of various diseases. Overall, PYRROLIDINE-1-CARBOXIMIDAMIDE HYDROIODIDE plays a crucial role in the advancement of chemical and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 102392-83-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,3,9 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 102392-83:
(8*1)+(7*0)+(6*2)+(5*3)+(4*9)+(3*2)+(2*8)+(1*3)=96
96 % 10 = 6
So 102392-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H11N3.HI/c6-5(7)8-3-1-2-4-8;/h1-4H2,(H3,6,7);1H
