102408-25-3 Usage
Description
2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE is a pale brownish-yellow solid that exhibits an extraordinarily high mutagenic potency in the Ames test. 2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE is characterized by its unique chemical structure and properties, making it a compound of interest for further research and potential applications.
Uses
Used in Research and Development:
2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE is used as a research compound for studying its mutagenic properties and potential applications in various fields. Its high mutagenic potency in the Ames test makes it a valuable tool for understanding the mechanisms of mutagenesis and the development of new drugs or therapies.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE is used as a starting material or intermediate for the synthesis of various drugs. Its unique chemical structure and properties may contribute to the development of novel therapeutic agents with specific applications.
Used in Chemical Synthesis:
2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE is used as a chemical intermediate for the synthesis of other organic compounds. Its versatile structure allows for further functionalization and modification, leading to the creation of new molecules with potential applications in various industries.
Used in Environmental Monitoring:
Due to its high mutagenic potency, 2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE can be used in environmental monitoring to detect and assess the presence of mutagenic substances in the environment. This can help in understanding the impact of pollutants on ecosystems and human health.
Used in Toxicology Studies:
2-AMINO-1-METHYL-3H-IMIDAZO[4,5-F]QUINOLINE can be employed in toxicology studies to evaluate the potential toxic effects of various substances. Its mutagenic properties can provide insights into the mechanisms of toxicity and help in the development of safer chemicals and products.
Check Digit Verification of cas no
The CAS Registry Mumber 102408-25-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,0 and 8 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 102408-25:
(8*1)+(7*0)+(6*2)+(5*4)+(4*0)+(3*8)+(2*2)+(1*5)=73
73 % 10 = 3
So 102408-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N4/c1-15-10-7-3-2-6-13-8(7)4-5-9(10)14-11(15)12/h2-6H,1H3,(H2,12,14)
102408-25-3Relevant articles and documents
CONVENIENT SYNTHESIS OF THE FOOD MUTAGEN 2-AMINO-3-METHYLIMIDAZOQUINOLINE (iq), AND IQ-D3
Ziv, Joseph,Knapp, Spencer,Rosen, Joseph D.
, p. 973 - 980 (2007/10/02)
The title compounds (5 and 10) were each prepared in four steps from commercially available 5-amino-6-nitroquinoline (1) in 41percent overall yield.The key step was the displacement of the methylsulfonyl group of 4 by sodamine.