10241-98-2 Usage
General Description
CHEMBRDG-BB 4004896 is a chemical compound with the molecular formula C16H25NO2. It is a derivative of the neurotransmitter dopamine, and is known to have anxiolytic and anti-depressant properties. It has been studied for its potential use in treating neurological disorders and mood disorders. Additionally, it has also been investigated for its potential to inhibit the growth of certain cancer cells. CHEMBRDG-BB 4004896 is a promising compound that shows potential for various therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10241-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,4 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10241-98:
(7*1)+(6*0)+(5*2)+(4*4)+(3*1)+(2*9)+(1*8)=62
62 % 10 = 2
So 10241-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-3,8,11H,4H2,(H,12,13)
