102434-22-0 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-Bromoethyl)-3-diphenylmethylurea is used as a research compound for its potential applications in drug discovery and development. Its unique structure allows for exploration in the creation of new pharmaceutical agents, particularly those targeting specific biological pathways or receptors.
Used in Agrochemical Industry:
In the agrochemical industry, 1-(2-Bromoethyl)-3-diphenylmethylurea is used as a research compound to develop new products for pest control, weed management, and other agricultural applications. Its chemical properties make it a valuable tool in the design and synthesis of novel agrochemicals.
Used in Organic Synthesis:
1-(2-Bromoethyl)-3-diphenylmethylurea is used as an intermediate in organic synthesis, playing a crucial role in the production of various chemical products. Its structural components can be manipulated to create a range of compounds with different applications in various industries.
Used in Chemical Industry:
Within the chemical industry, 1-(2-Bromoethyl)-3-diphenylmethylurea is utilized for the synthesis of other organic compounds, contributing to the development of new materials and products with diverse applications, such as in the manufacturing of pharmaceuticals, agrochemicals, and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 102434-22-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,3 and 4 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 102434-22:
(8*1)+(7*0)+(6*2)+(5*4)+(4*3)+(3*4)+(2*2)+(1*2)=70
70 % 10 = 0
So 102434-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H17BrN2O/c17-11-12-18-16(20)19-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H2,18,19,20)
