102434-27-5 Usage
Uses
Used in Pharmaceutical Development:
1-(2-Bromoethyl)-3-(4-isopropoxy-1-naphthalenemethyl)urea is used as a starting compound in the pharmaceutical industry for the synthesis of other derivatives with similar structures and properties. Its unique chemical composition, featuring bromoethyl and naphthalenemethyl groups, may contribute to specific chemical and biological properties, making it a valuable asset in the creation of new medications and therapies.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 1-(2-Bromoethyl)-3-(4-isopropoxy-1-naphthalenemethyl)urea serves as a key compound for exploring its potential applications in the development of biologically active molecules. 1-(2-Bromoethyl)-3-(4-isopropoxy-1-naphthalenemethyl)urea's structure allows for further investigation into its interactions with biological systems, which could lead to the discovery of novel therapeutic approaches and treatments for various medical conditions.
Used in Organic Synthesis:
1-(2-Bromoethyl)-3-(4-isopropoxy-1-naphthalenemethyl)urea is also utilized in organic synthesis, where it can be employed as a building block for creating a variety of complex organic molecules. Its unique structure and functional groups make it a versatile component in the synthesis of new compounds with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 102434-27-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,3 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 102434-27:
(8*1)+(7*0)+(6*2)+(5*4)+(4*3)+(3*4)+(2*2)+(1*7)=75
75 % 10 = 5
So 102434-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C17H21BrN2O2/c1-12(2)22-16-8-7-13(11-20-17(21)19-10-9-18)14-5-3-4-6-15(14)16/h3-8,12H,9-11H2,1-2H3,(H2,19,20,21)
