102434-34-4 Usage
Uses
1. Used in Pharmaceutical Applications:
1-(2-Bromoethyl)-3-(4-propoxy-1-naphthalenemethyl)urea is used as a pharmaceutical compound for its potential biological and medicinal properties. 1-(2-Bromoethyl)-3-(4-propoxy-1-naphthalenemethyl)urea's unique structure, which includes a bromoethyl group and a naphthalenemethyl group, may contribute to its effectiveness in various therapeutic applications. However, further research is required to fully understand its potential uses and effects in the pharmaceutical industry.
2. Used in Chemical Applications:
In the chemical industry, 1-(2-Bromoethyl)-3-(4-propoxy-1-naphthalenemethyl)urea may be utilized for various purposes, such as a starting material or intermediate in the synthesis of other compounds. Its unique structure and functional groups could be valuable in the development of new chemical products or processes. However, the specific applications and potential of 1-(2-Bromoethyl)-3-(4-propoxy-1-naphthalenemethyl)urea in the chemical industry would depend on the context and requirements of each particular application.
Check Digit Verification of cas no
The CAS Registry Mumber 102434-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,3 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 102434-34:
(8*1)+(7*0)+(6*2)+(5*4)+(4*3)+(3*4)+(2*3)+(1*4)=74
74 % 10 = 4
So 102434-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H21BrN2O2/c1-2-11-22-16-8-7-13(12-20-17(21)19-10-9-18)14-5-3-4-6-15(14)16/h3-8H,2,9-12H2,1H3,(H2,19,20,21)
