102489-51-0 Usage
Molecular structure
The compound consists of a diethylammonium cation and a chloride anion, with a carbamoylmethyl group attached to a 2-chloro-6-methyl-phenyl ring, a propylaminoethyl group, and two ethyl groups attached to the amino nitrogen.
Functional groups
The presence of carbamoylmethyl, propylaminoethyl, and two ethyl groups contribute to the compound's unique properties and reactivity.
Aromatic ring
The 2-chloro-6-methyl-phenyl ring provides stability and contributes to the compound's structure.
Potential applications
The compound has potential uses in organic synthesis and pharmaceuticals due to its unique structure and properties.
Need for further research
To fully understand the compound's potential uses and effects, additional research and characterization are required.
Check Digit Verification of cas no
The CAS Registry Mumber 102489-51-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,8 and 9 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 102489-51:
(8*1)+(7*0)+(6*2)+(5*4)+(4*8)+(3*9)+(2*5)+(1*1)=110
110 % 10 = 0
So 102489-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H30ClN3O.ClH/c1-6-21(7-2)11-12-22(14(3)4)13-17(23)20-18-15(5)9-8-10-16(18)19;/h8-10,14H,6-7,11-13H2,1-5H3,(H,20,23);1H
