102489-54-3 Usage
General Description
The chemical compound "2-[(2-chloro-6-methyl-phenyl)carbamoylmethyl-(2-phenoxyethyl)amino]ethyl-diethyl-azanium chloride" is a complex organic molecule consisting of a central nitrogen atom with two ethyl groups attached. It also contains a carbamoylmethyl group, a chloro-6-methyl-phenyl group, and a phenoxyethyl group. It is a quaternary ammonium compound, meaning it contains a positively charged nitrogen atom. 2-[(2-chloro-6-methyl-phenyl)carbamoylmethyl-(2-phenoxyethyl)amino]eth yl-diethyl-azanium chloride may have potential applications in various industries such as pharmaceuticals, agriculture, or chemical synthesis due to its unique structure and properties. Further research and testing are necessary to fully understand its potential uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 102489-54-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,4,8 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 102489-54:
(8*1)+(7*0)+(6*2)+(5*4)+(4*8)+(3*9)+(2*5)+(1*4)=113
113 % 10 = 3
So 102489-54-3 is a valid CAS Registry Number.
InChI:InChI=1/C23H32ClN3O2.ClH/c1-4-26(5-2)14-15-27(16-17-29-20-11-7-6-8-12-20)18-22(28)25-23-19(3)10-9-13-21(23)24;/h6-13H,4-5,14-18H2,1-3H3,(H,25,28);1H