102516-99-4 Usage
General Description
The chemical compound 2-(dodecylsulfanylmethyl)-1,3-dihydrobenzoimidazole chloride is a type of benzoimidazole compound that contains a dodecylsulfanylmethyl group. It is commonly used as an antifungal and antimicrobial agent due to its ability to inhibit the growth of various microorganisms. The compound is typically found in pharmaceuticals and personal care products, where it is used to prevent the growth of fungi and bacteria. Additionally, it has been studied for its potential applications in agriculture as a fungicide. Overall, this chemical compound plays a crucial role in the prevention and control of microbial growth in a wide range of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 102516-99-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,5,1 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 102516-99:
(8*1)+(7*0)+(6*2)+(5*5)+(4*1)+(3*6)+(2*9)+(1*9)=94
94 % 10 = 4
So 102516-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H32N2S.ClH/c1-2-3-4-5-6-7-8-9-10-13-16-23-17-20-21-18-14-11-12-15-19(18)22-20;/h11-12,14-15H,2-10,13,16-17H2,1H3,(H,21,22);1H
