10252-89-8 Usage
Uses
Used in Pharmaceutical Research:
3-(5-CHLORO-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL is used as a chemical intermediate for the development of new pharmaceutical compounds. Its unique structure may contribute to the discovery of novel drugs with specific therapeutic properties.
Used in Chemical Research:
3-(5-CHLORO-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL is used as a research compound to study its chemical properties and potential interactions with other molecules. This can lead to a better understanding of its behavior and possible applications in various chemical processes.
Note: The specific applications and uses of 3-(5-CHLORO-1H-BENZO[D]IMIDAZOL-2-YL)PROPAN-1-OL would need to be further investigated through experimentation and analysis to confirm its potential and safety in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10252-89-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,5 and 2 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10252-89:
(7*1)+(6*0)+(5*2)+(4*5)+(3*2)+(2*8)+(1*9)=68
68 % 10 = 8
So 10252-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClN2O/c11-7-3-4-8-9(6-7)13-10(12-8)2-1-5-14/h3-4,6,14H,1-2,5H2,(H,12,13)
Xn:Harmful;
