102520-50-3 Usage
Molecular structure
Contains a spiro ring system with a dioxane and aziridine ring fused together.
Functional groups
Features a methyl group at the 7th position and a phenylmethyl group at the 6th position.
Potential applications
May have utility in various pharmaceutical and medicinal applications due to its structural complexity and the presence of functional groups that could interact with biological systems.
Research and evaluation
Further research and evaluation are needed to determine its specific properties and potential uses.
Molecular weight
Approximately 237.33 g/mol (calculated from the chemical formula).
Stereochemistry
The molecule may exhibit stereoisomerism due to the presence of chiral centers (e.g., the carbon atoms in the aziridine ring and the phenylmethyl group).
Solubility
The solubility of the compound in various solvents is not provided, but it may be influenced by the presence of polar and nonpolar functional groups.
Stability
The stability of the compound under different conditions (e.g., temperature, pH, etc.) is not provided, but it may be affected by the presence of reactive functional groups such as the aziridine ring.
Reactivity
The reactivity of the compound with other molecules or functional groups is not provided, but it may be influenced by the presence of the phenylmethyl and methyl groups, as well as the aziridine ring.
Check Digit Verification of cas no
The CAS Registry Mumber 102520-50-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,5,2 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 102520-50:
(8*1)+(7*0)+(6*2)+(5*5)+(4*2)+(3*0)+(2*5)+(1*0)=63
63 % 10 = 3
So 102520-50-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H21NO2/c1-16-9-5-8-15(17-10-11-18-15)14(16)12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3
102520-50-3Relevant articles and documents
NOVEL COMPOUNDS FOR THE TREATMENT OF HYPERTENSION
-
, (2008/06/13)
Compounds of the formulae: STR1 are useful as anti-hypertensives.
