102583-72-2 Usage
Uses
Used in Pharmaceutical Industry:
[1-(2-methoxyphenyl)propan-2-ylamino]-propan-2-yl-azanium chloride is used as a potential pharmaceutical compound for its possible applications in drug development. The specific properties of [1-(2-methoxyphenyl)propan-2-ylamino]-propan-2-yl-azanium chloride, including its cationic nature and the presence of the propan-2-ylamino and 2-methoxyphenyl groups, may make it a candidate for further research and development in the pharmaceutical sector.
Used in Organic Synthesis:
In the field of organic synthesis, [1-(2-methoxyphenyl)propan-2-ylamino]-propan-2-yl-azanium chloride may serve as a reagent or intermediate in the synthesis of other complex organic molecules. Its unique structure could be utilized to create novel compounds with specific properties and potential applications.
Used in Industrial Processes:
[1-(2-methoxyphenyl)propan-2-ylamino]-propan-2-yl-azanium chloride may also find use in various industrial processes, where its unique structure and properties could be harnessed for specific applications. Further research and investigation would be necessary to determine the exact uses and benefits of [1-(2-methoxyphenyl)propan-2-ylamino]-propan-2-yl-azanium chloride in industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 102583-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,5,8 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 102583-72:
(8*1)+(7*0)+(6*2)+(5*5)+(4*8)+(3*3)+(2*7)+(1*2)=102
102 % 10 = 2
So 102583-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H22N2O.ClH/c1-10(2)14-15-11(3)9-12-7-5-6-8-13(12)16-4;/h5-8,10-11,14-15H,9H2,1-4H3;1H
