102612-78-2 Usage
Chemical compound
A substance formed from two or more elements chemically bonded together in a fixed proportion.
Potential pharmaceutical and industrial applications
This compound may have uses in the development of drugs or in various industries, such as manufacturing or chemical production.
Derivative of 1,3-propanediol
The compound is derived from 1,3-propanediol, which is commonly used in the production of polymers and solvents.
Addition of allyl, methoxy, and pyrrolidinylmethyl groups
These groups are added to the compound, which may enhance its properties for use in medical applications.
Medical applications
The compound may be used in drug delivery systems or as an active pharmaceutical ingredient.
Interactions with receptors or enzymes
The specific structure of the compound suggests that it may have interactions with receptors or enzymes in the body, making it a potential candidate for further research and development.
Allyl and methoxy groups
These groups may provide opportunities for chemical modification to improve the compound's properties for specific applications.
Further research and development
The compound's potential interactions with receptors or enzymes in the body warrant further investigation to determine its suitability for medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 102612-78-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,6,1 and 2 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 102612-78:
(8*1)+(7*0)+(6*2)+(5*6)+(4*1)+(3*2)+(2*7)+(1*8)=82
82 % 10 = 2
So 102612-78-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H27NO4/c1-3-6-14-11-15(13-19-8-4-5-9-19)18(16(12-14)22-2)23-17(21)7-10-20/h3,11-12,17,20-21H,1,4-10,13H2,2H3
