102613-40-1 Usage
General Description
1-Methoxy-1-methyl-3-(1-naphthyl)urea is a chemical compound with the molecular formula C13H16N2O2. It is a derivative of urea and contains a methoxy group, a methyl group, and a naphthyl group. 1-Methoxy-1-methyl-3-(1-naphtyl)urea is often used as a pharmaceutical intermediate and in the synthesis of other organic compounds. It has potential applications in the field of medicinal chemistry and drug development due to its unique structural properties. Additionally, it may also have uses in the field of organic synthesis and materials science. Overall, 1-Methoxy-1-methyl-3-(1-naphthyl)urea is a versatile compound with diverse potential applications in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 102613-40-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,6,1 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 102613-40:
(8*1)+(7*0)+(6*2)+(5*6)+(4*1)+(3*3)+(2*4)+(1*0)=71
71 % 10 = 1
So 102613-40-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2/c1-15(17-2)13(16)14-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,1-2H3,(H,14,16)