102613-42-3 Usage
General Description
1-(4-Methoxy-1-naphthyl)-3-methylurea, also known as MoNAU, is a synthetic chemical compound that belongs to the class of urea derivatives. It is a derivative of 1-naphthyl, which is a monocyclic aromatic hydrocarbon. The presence of a methoxy group in the 4-position of the naphthyl ring and a methyl group attached to the urea nitrogen gives this compound its unique structure and properties. MoNAU is primarily used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It is also used as a building block in organic synthesis for the production of complex molecules. Additionally, it has potential applications in medicinal chemistry and drug discovery due to its structural features. Overall, 1-(4-Methoxy-1-naphthyl)-3-methylurea has diverse utility in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 102613-42-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,2,6,1 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 102613-42:
(8*1)+(7*0)+(6*2)+(5*6)+(4*1)+(3*3)+(2*4)+(1*2)=73
73 % 10 = 3
So 102613-42-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2/c1-14-13(16)15-11-7-8-12(17-2)10-6-4-3-5-9(10)11/h3-8H,1-2H3,(H2,14,15,16)