10268-27-6 Usage
General Description
1-(4-chlorophenyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound that belongs to the class of tetrahydroisoquinolines. It is a hydrochloride salt form of the compound, and it may have potential pharmaceutical applications due to its structural properties. The presence of a chlorophenyl group and methoxy groups on the tetrahydroisoquinoline backbone suggests potential pharmacological activities and bioavailability. However, further research and studies are needed to fully understand the chemical properties and potential medical uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 10268-27-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,6 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10268-27:
(7*1)+(6*0)+(5*2)+(4*6)+(3*8)+(2*2)+(1*7)=76
76 % 10 = 6
So 10268-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H18ClNO2.ClH/c1-20-15-9-12-7-8-19-17(14(12)10-16(15)21-2)11-3-5-13(18)6-4-11;/h3-6,9-10,17,19H,7-8H2,1-2H3;1H