102696-47-9Relevant academic research and scientific papers
Synthesis and IR, UV, NMR (1H and 11B), and mass spectral studies of new β-ketoamine complexes of boron: Crystal and molecular structure of OC6H4OBOC(R)CHC(R′)NR″ (R = p-ClC6H4, R′ = C6H5, R″ = CH3)
Singh, Yash P.,Rupani,Singh, Anirudh,Rai, Audhesh K.,Mehrotra, Ram C.,Rogers, Robin D.,Atwood, Jerry L.
, p. 3076 - 3081 (2008/10/08)
Twelve new β-ketoamine complexes of boron have been synthesized and assigned tetrahedral geometry by their IR, UV, and NMR (1H, 11B) spectral and other physicochemical measurements. The mass spectrum of OC6H4OBOC(CH3)CHC(CH3)NCH 3 is interpreted. OC6H4OBOC(R)CHC(R′)NR″ (R = p-ClC6H4, R′ = C6H5, R″ = CH3) crystallizes in the triclinic space group P1 with a = 8.577 (4) A?, b = 10.656 (5) A?, c = 11.598 (5) A?, α = 84.77 (4)°, β = 83.25 (4)°, γ = 67.38 (4)°, and Dc = 1.33 g cm-3 for two molecules per unit cell. The structure has been refined to R = 0.088 for 864 reflections. Each boron atom is bonded to one catechol and one β-ketoamine moiety. The tetrahedral environment around the boron atom is made up of two oxygen atoms from the catechol and an oxygen and a nitrogen atom from the β-ketoamine ligand.
