1027-01-6 Usage
Description
Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-phenyl-, is a heterocyclic aromatic compound characterized by the presence of both an imidazole and pyridine ring, along with a phenyl group. With the molecular formula C15H10N2O2, this chemical compound is utilized in pharmaceutical and medicinal applications, primarily as a building block in the synthesis of biologically active compounds. Its potential therapeutic effects and applications in drug development and medicinal chemistry have been the subject of research.
Uses
Used in Pharmaceutical and Medicinal Chemistry:
Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-phenyl-, serves as a key building block in the synthesis of biologically active compounds. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Drug Development:
Imidazo[1,2-a]pyridine-6-carboxylicacid, 2-phenylis utilized in drug development for its potential therapeutic effects. Its presence in various chemical structures allows for the exploration of its efficacy in treating different diseases and conditions, contributing to the advancement of medicinal chemistry.
Used in Research and Development:
Imidazo[1,2-a]pyridine-6-carboxylic acid, 2-phenyl-, is employed in research and development for its potential applications in various industries. Its unique chemical properties and structure make it a promising candidate for further exploration and utilization in the creation of innovative products and solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 1027-01-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,2 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1027-01:
(6*1)+(5*0)+(4*2)+(3*7)+(2*0)+(1*1)=36
36 % 10 = 6
So 1027-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H10N2O2/c17-14(18)11-6-7-13-15-12(9-16(13)8-11)10-4-2-1-3-5-10/h1-9H,(H,17,18)