10277-04-0 Usage
General Description
2-[bis(2-hydroxyethyl)amino]ethyl oleate is a chemical compound composed of two hydroxyethylamine groups attached to an ethyl oleate molecule. It is often used as a surfactant in various industrial applications, such as in the production of personal care products and pharmaceuticals. The compound has emulsifying properties, which allow it to effectively mix oil and water-based substances. Additionally, 2-[bis(2-hydroxyethyl)amino]ethyl oleate can also act as a conditioning agent, providing moisturizing and softening effects on skin and hair. Its versatile properties make it a valuable ingredient in many different formulations across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10277-04-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,7 and 7 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10277-04:
(7*1)+(6*0)+(5*2)+(4*7)+(3*7)+(2*0)+(1*4)=70
70 % 10 = 0
So 10277-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C24H47NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-24(28)29-23-20-25(18-21-26)19-22-27/h9-10,26-27H,2-8,11-23H2,1H3/b10-9-