102808-00-4

Usage

InChI:InChI=1/C11H10N2O/c14-9-11-6-7-12-13(11)8-10-4-2-1-3-5-10/h1-7,9H,8H2

Downstream Products

• 1620096-64-1 C₁₂H₁₀F₂N₂ 
• 1620096-05-0 1-benzyl-5-(2,2,2-trifluoroethyl)-1H-pyrazole 

Relevant academic research and scientific papers

Synthesizing process of nitrogen-heterocyclic high-selectivity aldehyde

The invention relates to a synthesizing process of nitrogen-heterocyclic high-selectivity aldehyde. The synthesizing process is characterized in that when nitrogen-heterocyclic nitrogen atoms have hydrogen atoms, pyrrole, piperidine and pyrazole are used as the initial raw materials, and the pyrrole, the piperidine and the pyrazole are allowed to have reaction with piperidine-1-formaldehyde under nitrogen atom protection to obtain required nitrogen-atom ortho-position aldehyde; when nitrogen-heterocyclic nitrogen atoms have no hydrogen atoms, pyridine and pyrimidine are used to have reaction with the piperidine-1-formaldehyde to obtain the required nitrogen-atom ortho-position aldehyde. The synthesizing process is simple to operate, few in steps and high in selectivity and is a universal method using nitrogen heterocycle to synthesize the nitrogen ortho-position aldehyde.