10291-27-7 Usage
General Description
2,5-bis(2-chloroanilino)terephthalic acid is a chemical compound with the molecular formula C20H14Cl4N2O4. It is a derivative of terephthalic acid and contains two chlorine atoms and two aniline groups. 2,5-bis(2-chloroanilino)terephthalic acid is often used as a building block for the synthesis of various organic materials, such as polymers and dyes. It is known for its ability to form covalent bonds with other molecules and has been studied extensively for its potential applications in the fields of medicinal chemistry and material science. The presence of chlorine atoms and aniline groups in its structure gives 2,5-bis(2-chloroanilino)terephthalic acid unique chemical properties and makes it a valuable compound in various industrial and scientific applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10291-27-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,9 and 1 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10291-27:
(7*1)+(6*0)+(5*2)+(4*9)+(3*1)+(2*2)+(1*7)=67
67 % 10 = 7
So 10291-27-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H14Cl2N2O4/c21-13-5-1-3-7-15(13)23-17-9-12(20(27)28)18(10-11(17)19(25)26)24-16-8-4-2-6-14(16)22/h1-10,23-24H,(H,25,26)(H,27,28)
10291-27-7Relevant articles and documents
Quinacridone pigment compositions comprising unsymmetrically substituted components
-
Page 12, (2010/02/10)
The present invention relates to a novel quinacridone pigment compositions, a process using a mixed amine synthesis for the ultimate production of the compositions and to their use as colorants for pigmenting high molecular weight organic materials.