1029654-26-9 Usage
Uses
Used in Organic Synthesis:
2-METHOXY-6-PHENYLPYRIDINE-3-BORONIC ACID is used as a reagent for the formation of carbon-carbon and carbon-heteroatom bonds. Its boronic acid functionality enables it to participate in various organic reactions, facilitating the synthesis of complex organic molecules.
Used in Pharmaceutical and Agrochemical Preparation:
2-METHOXY-6-PHENYLPYRIDINE-3-BORONIC ACID is used as a building block in the preparation of various pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable component in the development of new drugs and pesticides.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
In the field of medicinal and materials chemistry, 2-METHOXY-6-PHENYLPYRIDINE-3-BORONIC ACID is used as a versatile reagent in Suzuki-Miyaura cross-coupling reactions. This reaction is a powerful method for the formation of carbon-carbon bonds, allowing for the synthesis of a wide range of organic compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1029654-26-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,0,2,9,6,5 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1029654-26:
(9*1)+(8*0)+(7*2)+(6*9)+(5*6)+(4*5)+(3*4)+(2*2)+(1*6)=149
149 % 10 = 9
So 1029654-26-9 is a valid CAS Registry Number.
InChI:InChI=1S/C12H12BNO3/c1-17-12-10(13(15)16)7-8-11(14-12)9-5-3-2-4-6-9/h2-8,15-16H,1H3
