103-21-9 Usage
Uses
Used in Pharmaceutical Industry:
[1-methyl-3-(4-methylphenyl)triazen-2-yl]acetic acid is used as a pharmaceutical intermediate for the synthesis of various drugs. Its triazene functional group and acetic acid moiety provide a versatile chemical scaffold for the development of new therapeutic agents.
Used in Chemical Research:
In the field of chemical research, [1-methyl-3-(4-methylphenyl)triazen-2-yl]acetic acid serves as a valuable compound for studying the properties and reactivity of triazene derivatives. Its unique structure allows researchers to explore new reaction pathways and mechanisms, contributing to the advancement of organic chemistry.
Used in Material Science:
[1-methyl-3-(4-methylphenyl)triazen-2-yl]acetic acid can be utilized in material science for the development of novel materials with specific properties. Its triazene group and acetic acid moiety can be incorporated into polymers, coatings, or other materials to impart desired characteristics such as stability, reactivity, or biocompatibility.
Used in Agrochemical Industry:
In the agrochemical industry, [1-methyl-3-(4-methylphenyl)triazen-2-yl]acetic acid may be employed as a precursor for the synthesis of pesticides or other agrochemicals. Its unique structure can be modified to create compounds with targeted biological activity, potentially leading to the development of more effective and environmentally friendly products.
Check Digit Verification of cas no
The CAS Registry Mumber 103-21-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,0 and 3 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103-21:
(5*1)+(4*0)+(3*3)+(2*2)+(1*1)=19
19 % 10 = 9
So 103-21-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O2/c1-8-3-5-9(6-4-8)11-12-13(2)7-10(14)15/h3-6H,7H2,1-2H3,(H,14,15)/b12-11+
