103029-74-9 Usage
Uses
Used in the Fragrance Industry:
2-Cyano-3-(3-pyridinyl)acrylic acid is used as a fragrance ingredient for its unique scent characteristics. Its distinct chemical structure contributes to the creation of novel and appealing fragrances in various consumer products.
Used in the Pharmaceutical Sector:
2-Cyano-3-(3-pyridinyl)acrylic acid is used as a pharmaceutical intermediate for the synthesis of various drugs. Its versatile chemical properties allow it to be a key component in the development of new medications with potential therapeutic benefits.
Used in Organic Synthesis:
2-Cyano-3-(3-pyridinyl)acrylic acid is used as a building block in organic synthesis for the creation of more complex organic compounds. Its unique structure and reactivity make it a valuable component in the synthesis of various organic molecules with diverse applications.
Used in Research and Industrial Applications:
2-Cyano-3-(3-pyridinyl)acrylic acid is used as a research chemical for studying its properties and potential applications. It is also utilized in industrial processes where its specific chemical characteristics are required for the development of new products or improvement of existing ones.
Safety Measures:
Due to its potential hazards, 2-Cyano-3-(3-pyridinyl)acrylic acid requires careful handling and the implementation of appropriate safety measures. Proper storage, handling, and disposal protocols should be followed to minimize risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 103029-74-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,2 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 103029-74:
(8*1)+(7*0)+(6*3)+(5*0)+(4*2)+(3*9)+(2*7)+(1*4)=79
79 % 10 = 9
So 103029-74-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O2/c10-5-8(9(12)13)4-7-2-1-3-11-6-7/h1-4,6H,(H,12,13)/p-1/b8-4+
