103079-11-4 Usage
General Description
2-Methyl-4-dibenzylaminobenzaldehyde-1,1-diphenylhydrazone is a specialty chemical compound with a relatively complex structure. It is produced by the process of chemical synthesis. The chemical structure involves a hydrazone group, which consists of a nitrogen-nitrogen double bond, and its properties are determined by this and other functional groups within its structure. The exact properties, uses, and safety information related to this chemical can vary and would be determined by specific scientific research and industry application. As its name suggests, it incorporates elements including carbon, hydrogen, and nitrogen, among possible others. Detailed information about its properties and potential applications would typically be provided by the manufacturer or supplier.
Check Digit Verification of cas no
The CAS Registry Mumber 103079-11-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,7 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 103079-11:
(8*1)+(7*0)+(6*3)+(5*0)+(4*7)+(3*9)+(2*1)+(1*1)=84
84 % 10 = 4
So 103079-11-4 is a valid CAS Registry Number.
InChI:InChI=1/C34H31N3/c1-26-13-12-19-32(23-26)36(34-20-11-10-14-27(34)2)33-22-21-29(28(3)24-33)25-35-37(30-15-6-4-7-16-30)31-17-8-5-9-18-31/h4-25H,1-3H3/b35-25+