103095-63-2 Usage
General Description
DL-3-Amino-3-(2-methoxyphenyl)propionic acid is a chemical compound with the molecular formula C10H13NO3. It is also known as 2-Methyl-3-amino-3-(o-methoxyphenyl)propanoic acid. DL-3-Amino-3-(2-methoxyphenyl)propionic acid is a derivative of amino acids and is commonly used in the pharmaceutical industry as a key intermediate in the synthesis of various drugs and medication. It has been found to possess analgesic and anti-inflammatory properties, making it a potential candidate for the development of new pain-relief medications. Additionally, it is also used as a building block in the production of other organic compounds, making it an important chemical in organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 103095-63-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,0,9 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103095-63:
(8*1)+(7*0)+(6*3)+(5*0)+(4*9)+(3*5)+(2*6)+(1*3)=92
92 % 10 = 2
So 103095-63-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13NO3/c1-14-9-5-3-2-4-7(9)8(11)6-10(12)13/h2-5,8H,6,11H2,1H3,(H,12,13)