1031-36-3 Usage
General Description
1-benzyl-4-(isopropylamino)piperidine-4-carboxamide is a chemical compound that belongs to the piperidine class of drugs. It is a derivative of piperidine and is commonly used as a research chemical. 1-benzyl-4-(isopropylamino)piperidine-4-carboxamide has been studied for its potential use in the treatment of various medical conditions, including neurological and psychiatric disorders. It acts as a potent and selective agonist for certain receptors in the central nervous system, leading to its potential use in the development of novel therapeutic agents. Additionally, it has also been investigated for its potential use as a substance of abuse due to its psychoactive effects. Further research is ongoing to determine the full range of its pharmacological properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1031-36-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,3 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1031-36:
(6*1)+(5*0)+(4*3)+(3*1)+(2*3)+(1*6)=33
33 % 10 = 3
So 1031-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H25N3O/c1-13(2)18-16(15(17)20)8-10-19(11-9-16)12-14-6-4-3-5-7-14/h3-7,13,18H,8-12H2,1-2H3,(H2,17,20)
