103204-34-8 Usage
Uses
Given the structure of 3-(2-Carbamoyl-phenoxy)-propionic acid, it can be presumed to have several potential uses across different industries, although more in-depth research is needed to confirm its exact properties and applications.
Used in Chemical Synthesis:
3-(2-Carbamoyl-phenoxy)-propionic acid is used as a chemical intermediate for the synthesis of various compounds due to its reactive carboxyl and carbamoyl groups, which can participate in a range of chemical reactions.
Used in Pharmaceutical Industry:
3-(2-Carbamoyl-phenoxy)-propionic acid is used as a potential metabolic intermediate or by-product in the development of pharmaceuticals, given its complex structure and the possibility of it being involved in biochemical pathways.
Used in Material Science:
3-(2-Carbamoyl-phenoxy)-propionic acid may be utilized in the development of new materials, such as polymers or composites, owing to its ability to participate in chemical reactions and form covalent bonds with other molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 103204-34-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,2,0 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 103204-34:
(8*1)+(7*0)+(6*3)+(5*2)+(4*0)+(3*4)+(2*3)+(1*4)=58
58 % 10 = 8
So 103204-34-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO4/c11-10(14)7-3-1-2-4-8(7)15-6-5-9(12)13/h1-4H,5-6H2,(H2,11,14)(H,12,13)
