10325-61-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
Oxazolo[5,4-d]pyrimidin-7-amine (9CI) is utilized as a building block in the synthesis of other compounds, particularly those with potential pharmaceutical applications. Its unique structure allows it to be a key component in the creation of novel molecules with therapeutic potential.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, Oxazolo[5,4-d]pyrimidin-7-amine (9CI) serves as a starting material for the development of new drugs. Its heterocyclic nature and the presence of nitrogen and oxygen atoms in its structure make it a versatile candidate for the design of bioactive molecules targeting various diseases and conditions.
Further research is essential to fully explore the chemical and biological properties of Oxazolo[5,4-d]pyrimidin-7-amine (9CI) and to uncover its full potential in various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10325-61-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10325-61:
(7*1)+(6*0)+(5*3)+(4*2)+(3*5)+(2*6)+(1*1)=58
58 % 10 = 8
So 10325-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N4O/c6-4-3-5(8-1-7-4)10-2-9-3/h1-2H,(H2,6,7,8)
