10325-61-8 Usage
Description
Oxazolo[5,4-d]pyrimidin-7-amine (9CI) is a heterocyclic amine with the molecular formula C6H5N3O. It features a fused ring structure that incorporates both oxygen and nitrogen atoms, which contributes to its unique chemical and potential biological properties. Oxazolo[5,4-d]pyrimidin-7-amine (9CI) holds promise in pharmaceutical research and drug development due to its distinctive structural characteristics and the possibility of exhibiting significant biological activity.
Uses
Used in Pharmaceutical Research and Drug Development:
Oxazolo[5,4-d]pyrimidin-7-amine (9CI) is utilized as a building block in the synthesis of other compounds, particularly those with potential pharmaceutical applications. Its unique structure allows it to be a key component in the creation of novel molecules with therapeutic potential.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, Oxazolo[5,4-d]pyrimidin-7-amine (9CI) serves as a starting material for the development of new drugs. Its heterocyclic nature and the presence of nitrogen and oxygen atoms in its structure make it a versatile candidate for the design of bioactive molecules targeting various diseases and conditions.
Further research is essential to fully explore the chemical and biological properties of Oxazolo[5,4-d]pyrimidin-7-amine (9CI) and to uncover its full potential in various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10325-61-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 10325-61:
(7*1)+(6*0)+(5*3)+(4*2)+(3*5)+(2*6)+(1*1)=58
58 % 10 = 8
So 10325-61-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N4O/c6-4-3-5(8-1-7-4)10-2-9-3/h1-2H,(H2,6,7,8)