10326-84-8 Usage
Heterocyclic compound
A compound that contains a ring structure with at least one non-carbon atom (such as nitrogen or oxygen) in the ring, contributing to its potential biological and pharmacological activities.
Sodium salt form
The presence of a sodium (Na+) ion in the compound, which increases its solubility in water, making it more suitable for certain applications in research and pharmaceuticals.
Potential biological activities
The compound may have interactions with biological systems, such as proteins, enzymes, or cell receptors, which could lead to various therapeutic effects.
Potential pharmacological activities
The compound may have applications in medicine, such as treating diseases or alleviating symptoms, due to its interactions with biological systems.
Anti-inflammatory potential
The compound may help reduce inflammation in the body, which can be beneficial in treating various conditions, such as arthritis or other inflammatory diseases.
Analgesic potential
The compound may have the ability to relieve pain, making it a potential candidate for pain management applications.
Anti-cancer potential
The compound may exhibit properties that inhibit or prevent the growth and spread of cancer cells, making it a potential target for cancer treatment research.
Research and pharmaceutical applications
The compound is often used in scientific research and the development of new pharmaceutical drugs due to its potential therapeutic effects and solubility advantages.
Need for further research and testing
More studies are required to fully understand the range of potential uses and effects of 1-Methylpyrido[1,2-a]benzimidazole-4-carboxylic acid sodium salt in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10326-84-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 6 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10326-84:
(7*1)+(6*0)+(5*3)+(4*2)+(3*6)+(2*8)+(1*4)=68
68 % 10 = 8
So 10326-84-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H10N2O2.Na/c1-8-6-7-9(13(16)17)12-14-10-4-2-3-5-11(10)15(8)12;/h2-7H,1H3,(H,16,17);/q;+1/p-1
