10326-85-9 Usage
Chemical class
Pyridine and pyrimidine derivatives
Type of compound
Sodium salt
Application
Pharmaceutical research and development
Therapeutic properties
Potential anti-inflammatory, anti-cancer, and antimicrobial effects
Structure
Unique chemical structure that contributes to its potential therapeutic properties
Bacterial growth inhibition
Has been studied for its potential to inhibit the growth of certain types of bacteria
Fungal growth inhibition
Has been studied for its potential to inhibit the growth of certain types of fungi
Further investigation
Valuable compound for additional research and potential drug development
These properties highlight the importance of 1,3-Dimethylpyrido[1,2-a]benzimidazole-4-carboxylic acid sodium salt in the field of pharmaceutical research and its potential applications in the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 10326-85-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 10326-85:
(7*1)+(6*0)+(5*3)+(4*2)+(3*6)+(2*8)+(1*5)=69
69 % 10 = 9
So 10326-85-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O2.Na/c1-8-7-9(2)16-11-6-4-3-5-10(11)15-13(16)12(8)14(17)18;/h3-7H,1-2H3,(H,17,18);/q;+1/p-1
