10326-86-0 Usage
General Description
1,2,3-Trimethylpyrido[1,2-a]benzimidazole-4-carboxylic acid sodium salt, also known as TMB-4-Na, is a chemical compound used in the pharmaceutical industry. It is a sodium salt form of a pyrido[1,2-a]benzimidazole-4-carboxylic acid derivative, which has potential anti-inflammatory and anti-cancer activities. TMB-4-Na is known for its ability to inhibit the proliferation of cancer cells and reducing inflammation. It is often used in research and drug development as a potential treatment for various diseases and conditions. 1,2,3-Trimethylpyrido[1,2-a]benzimidazole-4-carboxylic acid sodium salt is of interest to scientists and pharmaceutical companies due to its potential therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 10326-86-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10326-86:
(7*1)+(6*0)+(5*3)+(4*2)+(3*6)+(2*8)+(1*6)=70
70 % 10 = 0
So 10326-86-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H14N2O2.Na/c1-8-9(2)13(15(18)19)14-16-11-6-4-5-7-12(11)17(14)10(8)3;/h4-7H,1-3H3,(H,18,19);/q;+1/p-1