10329-37-0 Usage
Uses
Used in Polymer and Copolymer Production:
3-chloromethacrylonitrile is utilized as a monomer in the production of polymers and copolymers. Its high reactivity allows for the creation of various polymeric materials with specific properties, making it valuable in the chemical and materials science industries.
Used in Chemical Synthesis:
Due to its reactive nature, 3-chloromethacrylonitrile can be used as an intermediate in the synthesis of other chemical compounds. It can be incorporated into various chemical reactions to produce a range of products, including pharmaceuticals, agrochemicals, and specialty chemicals.
Used in Research and Development:
3-chloromethacrylonitrile's unique properties make it a valuable compound for research and development purposes. It can be used to study polymerization processes, investigate the effects of different monomers on polymer properties, and explore potential applications in various industries.
Used in Hazardous Material Management:
As a regulated hazardous material, 3-chloromethacrylonitrile requires proper handling, labeling, and storage. This involves the development and implementation of safety protocols and procedures to minimize the risk of accidental exposure and ensure the safe use of 3-chloromethacrylonitrile in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 10329-37-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 10329-37:
(7*1)+(6*0)+(5*3)+(4*2)+(3*9)+(2*3)+(1*7)=70
70 % 10 = 0
So 10329-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H4ClN/c1-4(2-5)3-6/h2H,1H3/b4-2-
