10329-60-9 Usage
General Description
Dioxifedrine, also known as 2-amino-1-phenylpropane, is a synthetic chemical compound commonly used as a nasal decongestant and bronchodilator. It functions by stimulating the sympathetic nervous system and activating adrenergic receptors, resulting in the relaxation of smooth muscles in the airways and nasal passages, which leads to improved airflow and reduced congestion. Dioxifedrine is also used as a precursor in the synthesis of other pharmaceutical drugs, such as amphetamine and methamphetamine. It is considered a Schedule III controlled substance in the United States due to its potential for abuse and dependence. Additionally, dioxifedrine has been banned for use in some countries due to its psychoactive and addictive properties.
Check Digit Verification of cas no
The CAS Registry Mumber 10329-60-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,2 and 9 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 10329-60:
(7*1)+(6*0)+(5*3)+(4*2)+(3*9)+(2*6)+(1*0)=69
69 % 10 = 9
So 10329-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO3/c1-6(11-2)10(14)7-3-4-8(12)9(13)5-7/h3-6,10-14H,1-2H3
