103408-63-5 Usage
Uses
Used in Pharmaceutical Industry:
2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-5-(tributylstannyl)is used as a key intermediate in the synthesis of flexible shape-modified nucleosides for the pharmaceutical industry. These modified nucleosides are essential in the development of novel therapeutic agents, as they can exhibit improved binding properties, enhanced stability, and reduced toxicity compared to their natural counterparts. The unique structure of 5-Tributylstannyl-1,3-dimethyluracil allows for the creation of diverse nucleoside analogs with potential applications in antiviral, anticancer, and anti-inflammatory treatments.
Used in Chemical Research:
In the field of chemical research, 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-5-(tributylstannyl)serves as a valuable compound for studying the reactivity and properties of organotin compounds. The tributylstannyl group can be used to investigate various reaction mechanisms, such as cross-coupling reactions, and to explore the potential of 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-5-(tributylstannyl)- as a precursor for the synthesis of other organotin derivatives with potential applications in materials science, catalysis, and environmental chemistry.
Used in Material Science:
2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-5-(tributylstannyl)can also be utilized in the development of new materials with unique properties. The incorporation of the tributylstannyl group into the pyrimidinedione framework may lead to the creation of materials with enhanced electronic, optical, or mechanical properties. These materials could find applications in various industries, such as electronics, photonics, and aerospace engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 103408-63-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,3,4,0 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 103408-63:
(8*1)+(7*0)+(6*3)+(5*4)+(4*0)+(3*8)+(2*6)+(1*3)=85
85 % 10 = 5
So 103408-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7N2O2.3C4H9.Sn/c1-7-4-3-5(9)8(2)6(7)10;3*1-3-4-2;/h4H,1-2H3;3*1,3-4H2,2H3;/rC18H34N2O2Sn/c1-6-9-12-23(13-10-7-2,14-11-8-3)16-15-19(4)18(22)20(5)17(16)21/h15H,6-14H2,1-5H3
